Dataset Viewer
Auto-converted to Parquet Duplicate
id
stringlengths
26
26
image
imagewidth (px)
118
1.88k
mol
stringlengths
951
16k
smiles
stringlengths
12
280
selfies
stringlengths
42
1.15k
inchi
stringlengths
45
896
US07314511-20080101-C00002
0020.cdx ChemDraw12120507302D 40 48 0 0 0 0 0 0 0 0999 V2000 -1.7944 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6987 0.7145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6951 1.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3819 1.9840 0.0000 C 0 ...
c1ccc2c(c1)C1=N/C2=N\C2=N/C(=N\C3=N/C(=N\C4=N/C(=N\1)c1ccccc14)c1ccccc13)c1ccccc12
[C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=N][/C][Ring1][=Branch1][=N][\C][=N][/C][=Branch2][Ring2][=Branch1][=N][\C][=N][/C][=Branch2][Ring1][Ring2][=N][\C][=N][/C][=Branch1][Ring2][=N][-\Ring1][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring...
InChI=1S/C32H16N8/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25/h1-16H/b37-25-,37-27-,38-26-,38-28-,39-29-,39-31-,40-30-,40-32-
US07314511-20080101-C00004
0040.cdx ChemDraw12120507342D 10 10 0 0 0 0 0 0 0 0999 V2000 -0.0553 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0553 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 0.4125 0.0000 C 0 ...
N#Cc1ccccc1C#N
[N][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][#N]
InChI=1S/C8H4N2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H
US07314511-20080101-C00006
0260.cdx ChemDraw12120507402D 32 34 0 0 0 0 0 0 0 0999 V2000 -2.1859 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1859 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4714 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7569 0.6187 0.0000 C 0 ...
Cc1ccc(S(=O)(=O)Oc2ccc(OS(=O)(=O)c3ccc(C)cc3)c(C#N)c2C#N)cc1
[C][C][=C][C][=C][Branch2][Ring2][=C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][C][=C][Branch2][Ring1][Ring2][O][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Branch1][Ring1][C][#N][=C][Ring2][Ring1][Ring1][C][#N][C][=C][Ring2][Ring1][#C]
InChI=1S/C22H16N2O6S2/c1-15-3-7-17(8-4-15)31(25,26)29-21-11-12-22(20(14-24)19(21)13-23)30-32(27,28)18-9-5-16(2)6-10-18/h3-12H,1-2H3
US07314511-20080101-C00007
0270.cdx ChemDraw12120507412D 26 28 0 0 0 0 0 0 0 0999 V2000 -0.4125 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4125 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1270 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8414 2.8875 0.0000 C 0 ...
Cc1ccc(Sc2ccc(Sc3ccc(C)cc3)c(C#N)c2C#N)cc1
[C][C][=C][C][=C][Branch2][Ring1][=C][S][C][=C][C][=C][Branch1][=N][S][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][Branch1][Ring1][C][#N][=C][Ring1][S][C][#N][C][=C][Ring2][Ring1][=Branch2]
InChI=1S/C22H16N2S2/c1-15-3-7-17(8-4-15)25-21-11-12-22(20(14-24)19(21)13-23)26-18-9-5-16(2)6-10-18/h3-12H,1-2H3
US07314511-20080101-C00008
0271.cdx ChemDraw12120507432D 30 32 0 0 0 0 0 0 0 0999 V2000 -0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0553 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 2.8875 0.0000 C 0 ...
CC(C)c1ccc(Sc2ccc(Sc3ccc(C(C)C)cc3)c(C#N)c2C#N)cc1
[C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring2][Ring1][S][C][=C][C][=C][Branch1][P][S][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][C][C][C][=C][Ring1][=Branch2][C][Branch1][Ring1][C][#N][=C][Ring2][Ring1][C][C][#N][C][=C][Ring2][Ring1][O]
InChI=1S/C26H24N2S2/c1-17(2)19-5-9-21(10-6-19)29-25-13-14-26(24(16-28)23(25)15-27)30-22-11-7-20(8-12-22)18(3)4/h5-14,17-18H,1-4H3
US07314511-20080101-C00009
0280.cdx ChemDraw12120507442D 32 36 0 0 0 0 0 0 0 0999 V2000 -0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0553 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 2.8875 0.0000 C 0 ...
N#Cc1c(Sc2ccc3ccccc3c2)ccc(Sc2ccc3ccccc3c2)c1C#N
[N][#C][C][=C][Branch1][S][S][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][C][Branch1][S][S][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][=C][Ring2][Ring1][N][C][#N]
InChI=1S/C28H16N2S2/c29-17-25-26(18-30)28(32-24-12-10-20-6-2-4-8-22(20)16-24)14-13-27(25)31-23-11-9-19-5-1-3-7-21(19)15-23/h1-16H
US07314511-20080101-C00010
0282.cdx ChemDraw12120507472D 24 26 0 0 0 0 0 0 0 0999 V2000 -0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1987 2.8875 0.0000 C 0 ...
N#Cc1c(Sc2ccccc2)ccc(Sc2ccccc2)c1C#N
[N][#C][C][=C][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][#Branch2][S][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][Ring2][C][#N]
InChI=1S/C20H12N2S2/c21-13-17-18(14-22)20(24-16-9-5-2-6-10-16)12-11-19(17)23-15-7-3-1-4-8-15/h1-12H
US07314511-20080101-C00011
0290.cdx ChemDraw12120508012D 26 28 0 0 0 0 0 0 0 0999 V2000 -0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1987 2.8875 0.0000 C 0 ...
Cc1ccccc1Sc1ccc(Sc2ccccc2C)c(C#N)c1C#N
[C][C][=C][C][=C][C][=C][Ring1][=Branch1][S][C][=C][C][=C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Branch1][Ring1][C][#N][=C][Ring1][S][C][#N]
InChI=1S/C22H16N2S2/c1-15-7-3-5-9-19(15)25-21-11-12-22(18(14-24)17(21)13-23)26-20-10-6-4-8-16(20)2/h3-12H,1-2H3
US07314511-20080101-C00012
0291.cdx ChemDraw12120508022D 26 28 0 0 0 0 0 0 0 0999 V2000 -0.7697 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7697 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4842 3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1987 2.8875 0.0000 C 0 ...
N#Cc1c(Sc2ccccc2Cl)ccc(Sc2ccccc2Cl)c1C#N
[N][#C][C][=C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][C][=C][C][Branch1][O][S][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][=C][Ring2][Ring1][=Branch1][C][#N]
InChI=1S/C20H10Cl2N2S2/c21-15-5-1-3-7-19(15)25-17-9-10-18(14(12-24)13(17)11-23)26-20-8-4-2-6-16(20)22/h1-10H
US07314543-20080101-C00003
0090.cdx ChemDraw03230509262D 11 11 0 0 0 0 0 0 0 0999 V2000 -2.5607 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5607 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8463 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1318 -0.8250 0.0000 C 0 ...
CC(=O)C=Cc1ccccc1
[C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]
InChI=1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3
US07314576-20080101-C00010
0009.cdx ChemDraw08070616162D 17 17 0 0 0 0 0 0 0 0999 V2000 -3.5001 -0.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6751 -0.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4202 0.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0876 0.8410 0.0000 O 0 ...
CCCCCCCCCC=C1CC(C)OC1=O
[C][C][C][C][C][C][C][C][C][C][=C][C][C][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C15H26O2/c1-3-4-5-6-7-8-9-10-11-14-12-13(2)17-15(14)16/h11,13H,3-10,12H2,1-2H3
US07314576-20080101-C00011
0010.cdx ChemDraw08070616182D 16 16 0 0 0 0 0 0 0 0999 V2000 -1.1299 -0.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1299 0.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9145 0.7815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.3994 0.1140 0.0000 C 0 ...
CC(CC=C1C[C@@H](C)OC1=O)CC(C)(C)C
[C][C][Branch1][=C][C][C][=C][C][C@@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O][C][C][Branch1][C][C][Branch1][C][C][C]
InChI=1S/C14H24O2/c1-10(9-14(3,4)5)6-7-12-8-11(2)16-13(12)15/h7,10-11H,6,8-9H2,1-5H3/t10?,11-/m1/s1
US07314576-20080101-C00012
0011.cdx ChemDraw08070616182D 14 15 0 0 0 0 0 0 0 0999 V2000 -1.4148 -0.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5898 -0.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3349 0.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0023 1.1114 0.0000 O 0 ...
CC1C/C(=C/C2CCCCC2)C(=O)O1
[C][C][C][/C][=Branch1][#Branch2][=C][/C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][Ring1][=N]
InChI=1S/C12H18O2/c1-9-7-11(12(13)14-9)8-10-5-3-2-4-6-10/h8-10H,2-7H2,1H3/b11-8-
US07314576-20080101-C00013
0012.cdx ChemDraw08070616192D 10 10 0 0 0 0 0 0 0 0999 V2000 0.6592 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4842 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7391 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 0.6348 0.0000 O 0 ...
CCCCC1CCC(=O)O1
[C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1]
InChI=1S/C8H14O2/c1-2-3-4-7-5-6-8(9)10-7/h7H,2-6H2,1H3
US07314576-20080101-C00014
0013.cdx ChemDraw08070616192D 11 11 0 0 0 0 0 0 0 0999 V2000 1.0164 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8414 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0964 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 0.6348 0.0000 O 0 ...
CCCCCC1CCC(=O)O1
[C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1]
InChI=1S/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3
US07314576-20080101-C00015
0014.cdx ChemDraw08070616202D 12 12 0 0 0 0 0 0 0 0999 V2000 1.3737 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1987 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4536 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7862 0.6348 0.0000 O 0 ...
CCCCCCC1CCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1]
InChI=1S/C10H18O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h9H,2-8H2,1H3
US07314576-20080101-C00016
0015.cdx ChemDraw08070616202D 13 13 0 0 0 0 0 0 0 0999 V2000 1.7309 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5559 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8109 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 0.6348 0.0000 O 0 ...
CCCCCCCC1CCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1]
InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-11(12)13-10/h10H,2-9H2,1H3
US07314576-20080101-C00017
0016.cdx ChemDraw08070616212D 14 14 0 0 0 0 0 0 0 0999 V2000 2.0881 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9131 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1681 0.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5006 0.6348 0.0000 O 0 ...
CCCCCCCCC1CCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][=Branch1]
InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h11H,2-10H2,1H3
US07314576-20080101-C00019
0018.cdx ChemDraw08070616222D 13 13 0 0 0 0 0 0 0 0999 V2000 2.0881 -1.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9131 -1.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1681 -0.2627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5006 0.2223 0.0000 C 0 ...
CCCCCCCC1CCOC1=O
[C][C][C][C][C][C][C][C][C][C][O][C][Ring1][Branch1][=O]
InChI=1S/C11H20O2/c1-2-3-4-5-6-7-10-8-9-13-11(10)12/h10H,2-9H2,1H3
US07314576-20080101-C00021
0020.cdx ChemDraw08070616232D 10 10 0 0 0 0 0 0 0 0999 V2000 0.4369 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4369 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2216 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7065 -0.0000 0.0000 O 0 ...
CCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C8H14O2/c1-3-4-7-5-6(2)10-8(7)9/h6-7H,3-5H2,1-2H3/t6-,7+/m0/s1
US07314576-20080101-C00022
0021.cdx ChemDraw08070616242D 11 11 0 0 0 0 0 0 0 0999 V2000 0.7942 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7942 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5788 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0637 -0.0000 0.0000 O 0 ...
CCCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C9H16O2/c1-3-4-5-8-6-7(2)11-9(8)10/h7-8H,3-6H2,1-2H3/t7-,8+/m0/s1
US07314576-20080101-C00023
0022.cdx ChemDraw08070616242D 12 12 0 0 0 0 0 0 0 0999 V2000 1.1514 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1514 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9360 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4209 -0.0000 0.0000 O 0 ...
CCCCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C10H18O2/c1-3-4-5-6-9-7-8(2)12-10(9)11/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1
US07314576-20080101-C00024
0023.cdx ChemDraw08070616252D 13 13 0 0 0 0 0 0 0 0999 V2000 1.5086 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5086 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2933 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7782 -0.0000 0.0000 O 0 ...
CCCCCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C11H20O2/c1-3-4-5-6-7-10-8-9(2)13-11(10)12/h9-10H,3-8H2,1-2H3/t9-,10+/m0/s1
US07314576-20080101-C00025
0024.cdx ChemDraw08070616252D 14 14 0 0 0 0 0 0 0 0999 V2000 1.8659 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8659 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6505 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1354 -0.0000 0.0000 O 0 ...
CCCCCCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C12H22O2/c1-3-4-5-6-7-8-11-9-10(2)14-12(11)13/h10-11H,3-9H2,1-2H3/t10-,11+/m0/s1
US07314576-20080101-C00026
0025.cdx ChemDraw08070616262D 15 15 0 0 0 0 0 0 0 0999 V2000 2.2231 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2231 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0077 -0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4927 -0.0000 0.0000 O 0 ...
CCCCCCCC[C@@H]1C[C@H](C)OC1=O
[C][C][C][C][C][C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O]
InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-12-10-11(2)15-13(12)14/h11-12H,3-10H2,1-2H3/t11-,12+/m0/s1
US07314576-20080101-C00027
0026.cdx ChemDraw08070616262D 16 16 0 0 0 0 0 0 0 0999 V2000 1.5086 0.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5086 -0.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2933 -0.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7782 -0.1340 0.0000 O 0 ...
CC(CC[C@@H]1C[C@H](C)OC1=O)CC(C)(C)C
[C][C][Branch1][=C][C][C][C@@H1][C][C@H1][Branch1][C][C][O][C][Ring1][=Branch1][=O][C][C][Branch1][C][C][Branch1][C][C][C]
InChI=1S/C14H26O2/c1-10(9-14(3,4)5)6-7-12-8-11(2)16-13(12)15/h10-12H,6-9H2,1-5H3/t10?,11-,12+/m0/s1
US07314576-20080101-C00028
0027.cdx ChemDraw08070616282D 14 15 0 0 0 0 0 0 0 0999 V2000 -2.1752 0.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1752 -0.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4607 -1.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7462 -0.7304 0.0000 C 0 ...
C[C@H]1C[C@@H](CC2CCCCC2)C(=O)O1
[C][C@H1][C][C@@H1][Branch1][#Branch2][C][C][C][C][C][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][Ring1][=N]
InChI=1S/C12H20O2/c1-9-7-11(12(13)14-9)8-10-5-3-2-4-6-10/h9-11H,2-8H2,1H3/t9-,11-/m0/s1
US07314576-20080101-C00029
0028.cdx ChemDraw08070616292D 13 13 0 0 0 0 0 0 0 0999 V2000 -2.4837 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6587 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4038 0.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.0712 0.5795 0.0000 C 0 ...
CCCCCC[C@]1(C)CCC(=O)O1
[C][C][C][C][C][C][C@][Branch1][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1]
InChI=1S/C11H20O2/c1-3-4-5-6-8-11(2)9-7-10(12)13-11/h3-9H2,1-2H3/t11-/m1/s1
US07314576-20080101-C00030
0029.cdx ChemDraw08070616292D 15 15 0 0 0 0 0 0 0 0999 V2000 -3.1982 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3732 -0.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1182 0.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7857 0.5795 0.0000 C 0 ...
CCCCCCCC[C@]1(C)CCC(=O)O1
[C][C][C][C][C][C][C][C][C@][Branch1][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1]
InChI=1S/C13H24O2/c1-3-4-5-6-7-8-10-13(2)11-9-12(14)15-13/h3-11H2,1-2H3/t13-/m1/s1
US07314576-20080101-C00031
0030.cdx ChemDraw08070616302D 12 13 0 0 0 0 0 0 0 0999 V2000 -1.3492 0.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3492 -0.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6348 -0.8972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0797 -0.4847 0.0000 C 0 ...
O=C1OC[C@H]2CCCC[C@@H]12
[O][=C][O][C][C@H1][C][C][C][C][C@@H1][Ring1][=Branch2][Ring1][=Branch1]
InChI=1S/C8H12O2/c9-8-7-4-2-1-3-6(7)5-10-8/h6-7H,1-5H2/t6-,7-/m1/s1
US07314576-20080101-C00032
0031.cdx ChemDraw08070616302D 12 12 0 0 0 0 0 0 0 0999 V2000 -2.8579 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -0.4125 0.0000 C 0 ...
CCCCCC1CCCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1]
InChI=1S/C10H18O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h9H,2-8H2,1H3
US07314576-20080101-C00033
0032.cdx ChemDraw08070616312D 13 13 0 0 0 0 0 0 0 0999 V2000 -2.5006 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7862 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3572 -0.4125 0.0000 C 0 ...
CCCCCCC1CCCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1]
InChI=1S/C11H20O2/c1-2-3-4-5-7-10-8-6-9-11(12)13-10/h10H,2-9H2,1H3
US07314576-20080101-C00034
0033.cdx ChemDraw08070616312D 14 14 0 0 0 0 0 0 0 0999 V2000 -2.1434 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.4125 0.0000 C 0 ...
CCCCCCCC1CCCC(=O)O1
[C][C][C][C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][Ring1][#Branch1]
InChI=1S/C12H22O2/c1-2-3-4-5-6-8-11-9-7-10-12(13)14-11/h11H,2-10H2,1H3
US07314576-20080101-C00035
0034.cdx ChemDraw08070616362D 24 24 0 0 0 0 0 0 0 0999 V2000 1.2281 -0.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0531 -0.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3080 0.6557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6406 1.1406 0.0000 C 0 ...
CCCCCCC1CCOC1=O.CCCCCCC1COC(=O)C1
[C][C][C][C][C][C][C][C][C][O][C][Ring1][Branch1][=O].[C][C][C][C][C][C][C][C][O][C][=Branch1][C][=O][C][Ring1][=Branch1]
InChI=1S/2C10H18O2/c1-2-3-4-5-6-9-7-10(11)12-8-9;1-2-3-4-5-6-9-7-8-12-10(9)11/h2*9H,2-8H2,1H3
US07314633-20080101-C00005
0440.cdx ChemDraw03080713532D 23 23 0 0 0 0 0 0 0 0999 V2000 -3.6877 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8627 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7862 1.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 1.0313 0.0000 C 0 ...
CCOC(=O)CC(C(=O)OCC)=C1CC(C)(C)N(O)C(C)(C)C1
[C][C][O][C][=Branch1][C][=O][C][C][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][=C][C][C][Branch1][C][C][Branch1][C][C][N][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][C][Ring1][O]
InChI=1S/C17H29NO5/c1-7-22-14(19)9-13(15(20)23-8-2)12-10-16(3,4)18(21)17(5,6)11-12/h21H,7-11H2,1-6H3
US07314653-20080101-C00090
0054.cdx ChemDraw04090518212D 17 18 0 0 0 0 0 0 0 0999 V2000 -3.0133 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8383 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9367 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5242 -0.7145 0.0000 C 0 ...
C=CC1CCC(c2ccc(C#N)cc2)CC1
[C][=C][C][C][C][C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][C][Ring1][=C]
InChI=1S/C15H17N/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h2,5-6,9-10,12,14H,1,3-4,7-8H2
US07314653-20080101-C00094
0058.cdx ChemDraw04090518262D 24 26 0 0 0 0 0 0 0 0999 V2000 0.1253 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9503 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9503 1.0717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1253 1.0717 0.0000 C 0 ...
C=CC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1
[C][=C][C][C][C][C][Branch2][Ring1][=Branch2][C][C][C][C][Branch1][#C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][F][=C][Ring1][Branch2][C][C][Ring1][=C][C][C][Ring2][Ring1][Ring2]
InChI=1S/C20H26F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-19(21)20(22)13-18/h2,11-17H,1,3-10H2
US07314653-20080101-C00109
0073.cdx ChemDraw04090518592D 18 19 0 0 0 0 0 0 0 0999 V2000 -2.0551 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8801 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6426 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8176 -0.7145 0.0000 C 0 ...
C=CC1CCC(C2CCC(CC)CC2)CC1
[C][=C][C][C][C][C][Branch1][=N][C][C][C][C][Branch1][Ring1][C][C][C][C][Ring1][Branch2][C][C][Ring1][=C]
InChI=1S/C16H28/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16/h3,13-16H,1,4-12H2,2H3
US07314653-20080101-C00118
0082.cdx ChemDraw04090521542D 25 26 0 0 0 0 0 0 0 0999 V2000 -2.6008 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1883 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3633 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9508 0.3572 0.0000 C 0 ...
Cc1cc(O)c(C(C)(C)C)cc1Cc1cc(C(C)(C)C)c(O)cc1C
[C][C][=C][C][Branch1][C][O][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][O][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][=C][Ring1][O][C]
InChI=1S/C23H32O2/c1-14-9-20(24)18(22(3,4)5)12-16(14)11-17-13-19(23(6,7)8)21(25)10-15(17)2/h9-10,12-13,24-25H,11H2,1-8H3
US07314653-20080101-C00119
0083.cdx ChemDraw04090521542D 28 29 0 0 0 0 0 0 0 0999 V2000 -2.5305 0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1180 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2930 -0.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8805 0.3572 0.0000 C 0 ...
Cc1cc(O)c(C(C)(C)C)cc1C(c1cc(C(C)(C)C)c(O)cc1C)C(C)C
[C][C][=C][C][Branch1][C][O][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][O][C][Branch2][Ring1][#Branch1][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][=C][Ring1][O][C][C][Branch1][C][C][C]
InChI=1S/C26H38O2/c1-15(2)24(18-13-20(25(5,6)7)22(27)11-16(18)3)19-14-21(26(8,9)10)23(28)12-17(19)4/h11-15,24,27-28H,1-10H3
US07314653-20080101-C00122
0086.cdx ChemDraw04090521572D 19 19 0 0 0 0 0 0 0 0999 V2000 -1.4156 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6469 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2344 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5906 -0.7145 0.0000 C 0 ...
CC(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C]
InChI=1S/C18H30O/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11,19H,1-9H3
US07314653-20080101-C00125
0089.cdx ChemDraw04090521592D 30 31 0 0 0 0 0 0 0 0999 V2000 0.3844 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7969 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6219 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0344 0.0000 0.0000 C 0 ...
CC(C)(C)c1cc(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch2][Ring1][S][C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][=Branch2][O]
InChI=1S/C28H42O2/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3
US07314653-20080101-C00126
0090.cdx ChemDraw04090522012D 25 27 0 0 0 0 0 0 0 0999 V2000 -1.7042 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7042 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9897 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2752 -1.4437 0.0000 C 0 ...
CC(C)(C)CC(C)(C)c1ccc(O)c(Cn2nc3ccccc3n2)c1
[C][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][C][O][C][Branch1][#C][C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Ring1][P]
InChI=1S/C21H27N3O/c1-20(2,3)14-21(4,5)16-10-11-19(25)15(12-16)13-24-22-17-8-6-7-9-18(17)23-24/h6-12,25H,13-14H2,1-5H3
US07314653-20080101-C00127
0091.cdx ChemDraw04090522022D 17 19 0 0 0 0 0 0 0 0999 V2000 -2.1742 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5867 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1742 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3492 -0.7145 0.0000 C 0 ...
Cc1ccc(O)c(-n2nc3ccccc3n2)c1
[C][C][=C][C][=C][Branch1][C][O][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Ring1][S]
InChI=1S/C13H11N3O/c1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16/h2-8,17H,1H3
US07314653-20080101-C00128
0092.cdx ChemDraw04090522032D 25 27 0 0 0 0 0 0 0 0999 V2000 -1.4289 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8579 1.8563 0.0000 C 0 ...
CC(C)(C)c1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][P][N][N][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][Ring1][#Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch1]
InChI=1S/C20H24ClN3O/c1-19(2,3)12-9-14(20(4,5)6)18(25)17(10-12)24-22-15-8-7-13(21)11-16(15)23-24/h7-11,25H,1-6H3
US07314653-20080101-C00129
0093.cdx ChemDraw04090522102D 24 26 0 0 0 0 0 0 0 0999 V2000 -1.5703 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5703 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2848 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9992 0.4125 0.0000 C 0 ...
CC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Ring2]
InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-21-15-9-7-8-10-16(15)22-23/h7-12,24H,1-6H3
US07314653-20080101-C00130
0094.cdx ChemDraw04090522112D 34 38 0 0 0 0 0 0 0 0999 V2000 -1.5150 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5150 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2295 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9440 0.4125 0.0000 C 0 ...
CC(C)(c1ccccc1)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)c2ccccc2)c1
[C][C][Branch1][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][=C][N][N][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring1][=Branch2][=C][Branch1][C][O][C][Branch1][S][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][=Branch2]
InChI=1S/C30H29N3O/c1-29(2,21-13-7-5-8-14-21)23-19-24(30(3,4)22-15-9-6-10-16-22)28(34)27(20-23)33-31-25-17-11-12-18-26(25)32-33/h5-20,34H,1-4H3
US07314653-20080101-C00131
0095.cdx ChemDraw04090522122D 27 29 0 0 0 0 0 0 0 0999 V2000 -2.5006 0.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5006 1.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2151 2.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9296 1.8010 0.0000 C 0 ...
COC(=O)CCc1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1
[C][O][C][=Branch1][C][=O][C][C][C][=C][C][Branch1][P][N][N][=C][C][=C][C][Branch1][C][Cl][=C][C][Ring1][#Branch1][=N][Ring1][#Branch2][=C][Branch1][C][O][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch1]
InChI=1S/C20H22ClN3O3/c1-20(2,3)14-9-12(5-8-18(25)27-4)10-17(19(14)26)24-22-15-7-6-13(21)11-16(15)23-24/h6-7,9-11,26H,5,8H2,1-4H3
US07314653-20080101-C00132
0096.cdx ChemDraw04090522142D 47 50 0 0 0 0 0 0 0 0999 V2000 -0.3572 2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3572 3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0717 4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7862 3.7125 0.0000 C 0 ...
CCCCCCCCCCCCOCC(O)COc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1
[C][C][C][C][C][C][C][C][C][C][C][C][O][C][C][Branch1][C][O][C][O][C][=C][C][=C][Branch2][Ring2][=Branch1][C][=N][C][Branch1][=N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=N][C][Branch1][=N][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=N][Ring2][Ring1][=Branch1][C][Branch1][C][O][=C][Ring2][R...
InChI=1S/C40H53N3O4/c1-6-7-8-9-10-11-12-13-14-15-22-46-26-32(44)27-47-33-18-21-36(37(45)25-33)40-42-38(34-19-16-28(2)23-30(34)4)41-39(43-40)35-20-17-29(3)24-31(35)5/h16-21,23-25,32,44-45H,6-15,22,26-27H2,1-5H3
US07314653-20080101-C00136
0100.cdx Mrv0541 08031212132D 28 30 0 0 0 0 999 V2000 -3.7696 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9446 -0.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5321 0.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9446 0.7697 0.0...
CCCC1CCC(C2CCC(c3ccc(CC(C)CC)cc3)CC2)CC1
[C][C][C][C][C][C][C][Branch2][Ring1][=N][C][C][C][C][Branch2][Ring1][C][C][=C][C][=C][Branch1][Branch2][C][C][Branch1][C][C][C][C][C][=C][Ring1][O][C][C][Ring1][P][C][C][Ring2][Ring1][#Branch1]
InChI=1S/C26H42/c1-4-6-21-7-11-23(12-8-21)25-15-17-26(18-16-25)24-13-9-22(10-14-24)19-20(3)5-2/h9-10,13-14,20-21,23,25-26H,4-8,11-12,15-19H2,1-3H3
US07314653-20080101-C00137
0100.cdx ChemDraw04090522192D 41 44 0 0 0 0 0 0 0 0999 V2000 -1.8213 -1.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4088 -1.9285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4088 -0.4995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6943 -1.5160 0.0000 C 0 ...
CCCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1
[C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C@H1][C][C][C@@][Branch1][C][C][C][=Branch2][Ring2][Branch1][=C][C][C@H1][C@@H1][C][C][C@H1][Branch1][=N][C@H1][Branch1][C][C][C][C][C][C][Branch1][C][C][C][C@@][Ring1][=N][Branch1][C][C][C][C][C@@H1][Ring2][Ring1][C][Ring2][Ring1][#Branch1][C][Ring2][Ring1][O]
InChI=1S/C36H62O2/c1-7-8-9-10-11-12-16-34(37)38-29-21-23-35(5)28(25-29)17-18-30-32-20-19-31(27(4)15-13-14-26(2)3)36(32,6)24-22-33(30)35/h17,26-27,29-33H,7-16,18-25H2,1-6H3/t27-,29+,30+,31-,32+,33+,35+,36-/m1/s1
US07314653-20080101-C00138
0102.cdx Mrv0541 08031212142D 36 38 0 0 0 0 999 V2000 -4.0081 -0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1831 -0.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1831 0.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0081 0.5150 0.0...
CCCCCCC(C)Oc1c(F)cc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1F
[C][C][C][C][C][C][C][Branch1][C][C][O][C][=C][Branch1][C][F][C][=C][Branch2][Ring1][#Branch2][C][C][C][C][Branch1][S][C][C][C][C][Branch1][=Branch1][C][C][C][C][C][C][C][Ring1][O][C][C][Ring1][P][C][=C][Ring2][Ring1][Branch2][F]
InChI=1S/C31H50F2O/c1-4-6-8-10-11-23(3)34-31-29(32)21-28(22-30(31)33)27-19-17-26(18-20-27)25-15-13-24(14-16-25)12-9-7-5-2/h21-27H,4-20H2,1-3H3
US07314653-20080101-C00141
0105.cdx ChemDraw04090522282D 36 39 0 0 0 0 0 0 0 0999 V2000 -3.6341 0.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8091 0.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3958 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8075 -0.7149 0.0000 C 0 ...
CCCCCCC(C)Oc1c(F)cc(-c2ccc(C34CCC(CCCCC)(CC3)CC4)cc2)cc1F
[C][C][C][C][C][C][C][Branch1][C][C][O][C][=C][Branch1][C][F][C][=C][Branch2][Ring2][C][C][=C][C][=C][Branch2][Ring1][=Branch1][C][C][C][C][Branch1][=Branch1][C][C][C][C][C][Branch1][Branch1][C][C][Ring1][O][C][C][Ring1][=N][C][=C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][#Branch2][F]
InChI=1S/C33H46F2O/c1-4-6-8-9-11-25(3)36-31-29(34)23-27(24-30(31)35)26-12-14-28(15-13-26)33-20-17-32(18-21-33,19-22-33)16-10-7-5-2/h12-15,23-25H,4-11,16-22H2,1-3H3
US07314654-20080101-C00014
024008.cdx ChemDraw06280519182D 168177 0 0 0 0 0 0 0 0999 V2000 -1.4289 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0313 0.0000 C ...
null
null
null
US07314654-20080101-C00028
0005.cdx ChemDraw06230508512D 19 19 0 0 0 0 0 0 0 0999 V2000 -4.5631 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7381 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7381 0.6187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.9131 -0.2063 0.0000 C 0 ...
C=CC(=O)OCCCCOc1ccc(C(C)=O)cc1
[C][=C][C][=Branch1][C][=O][O][C][C][C][C][O][C][=C][C][=C][Branch1][=Branch1][C][Branch1][C][C][=O][C][=C][Ring1][=Branch2]
InChI=1S/C15H18O4/c1-3-15(17)19-11-5-4-10-18-14-8-6-13(7-9-14)12(2)16/h3,6-9H,1,4-5,10-11H2,2H3
US07314691-20080101-C00001
0120.cdx ChemDraw09020522232D 12 9 0 0 0 0 0 0 0 0999 V2000 -1.3342 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5092 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9217 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5092 -0.7145 0.0000 O 0 ...
C.C.C=C(O)C(C)C(C)C(=O)O
[C].[C].[C][=C][Branch1][C][O][C][Branch1][C][C][C][Branch1][C][C][C][=Branch1][C][=O][O]
InChI=1S/C7H12O3.2CH4/c1-4(6(3)8)5(2)7(9)10;;/h4-5,8H,3H2,1-2H3,(H,9,10);2*1H4
US07314692-20080101-C00032
0320.cdx ChemDraw05220507472D 17 17 0 0 0 0 0 0 0 0999 V2000 -1.2375 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8250 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4125 -0.0000 0.0000 C 0 ...
CC(C)(C)c1cc(C=O)cc(C(C)(C)C)c1O
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch1][Ring1][C][=O][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][N][O]
InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-9,17H,1-6H3
US07314692-20080101-C00033
0330.cdx ChemDraw05220507472D 11 11 0 0 0 0 0 0 0 0999 V2000 -0.6187 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2062 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6187 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0313 -0.0000 0.0000 C 0 ...
NNc1ccc([N+](=O)[O-])cc1
[N][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]
InChI=1S/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2
US07314692-20080101-C00034
0331.cdx ChemDraw05220507502D 27 28 0 0 0 0 0 0 0 0999 V2000 -3.5062 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0938 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2687 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8563 -0.0000 0.0000 C 0 ...
CC(C)(C)c1cc(C=NNc2ccc([N+](=O)[O-])cc2)cc(C(C)(C)C)c1O
[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][Branch2][Ring1][Ring1][C][=N][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][=C][C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][=Branch1][O]
InChI=1S/C21H27N3O3/c1-20(2,3)17-11-14(12-18(19(17)25)21(4,5)6)13-22-23-15-7-9-16(10-8-15)24(26)27/h7-13,23,25H,1-6H3
US07314693-20080101-C00039
0001.cdx ChemDraw05010516422D 15 15 0 0 0 0 0 0 0 0999 V2000 -0.6666 0.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0791 0.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6666 -0.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1584 -0.6666 0.0000 C 0 ...
CCN(CC)c1ccc(C(C)(C)C)cc1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2]
InChI=1S/C14H23N/c1-6-15(7-2)13-10-8-12(9-11-13)14(3,4)5/h8-11H,6-7H2,1-5H3
US07314693-20080101-C00040
0002.cdx ChemDraw05010516432D 16 16 0 0 0 0 0 0 0 0999 V2000 -1.1822 0.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5947 -0.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1822 -1.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3572 -1.3534 0.0000 C 0 ...
CCN(CC)c1cccc(N(CC)CC)c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][Ring1][O]
InChI=1S/C14H24N2/c1-5-15(6-2)13-10-9-11-14(12-13)16(7-3)8-4/h9-12H,5-8H2,1-4H3
US07314693-20080101-C00041
0003.cdx ChemDraw05010516432D 16 16 0 0 0 0 0 0 0 0999 V2000 -0.4125 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8250 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4125 -1.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4125 -1.4289 0.0000 C 0 ...
CCN(CC)c1ccccc1N(CC)CC
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Branch1][Ring1][C][C][C][C]
InChI=1S/C14H24N2/c1-5-15(6-2)13-11-9-10-12-14(13)16(7-3)8-4/h9-12H,5-8H2,1-4H3
US07314693-20080101-C00042
0004.cdx ChemDraw05010516452D 16 17 0 0 0 0 0 0 0 0999 V2000 -0.3572 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3572 -1.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3572 -1.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0717 -1.0036 0.0000 C 0 ...
CCN(CC)c1c(C)ccc2ccccc12
[C][C][N][Branch1][Ring1][C][C][C][=C][Branch1][C][C][C][=C][C][=C][C][=C][C][=C][Ring1][O][Ring1][=Branch1]
InChI=1S/C15H19N/c1-4-16(5-2)15-12(3)10-11-13-8-6-7-9-14(13)15/h6-11H,4-5H2,1-3H3
US07314693-20080101-C00043
0005.cdx ChemDraw05010516462D 15 16 0 0 0 0 0 0 0 0999 V2000 -2.7369 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7369 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0225 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3080 -0.8250 0.0000 C 0 ...
CC(C)N(C)c1ccc2ccccc2c1
[C][C][Branch1][C][C][N][Branch1][C][C][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2]
InChI=1S/C14H17N/c1-11(2)15(3)14-9-8-12-6-4-5-7-13(12)10-14/h4-11H,1-3H3
US07314693-20080101-C00045
0007.cdx ChemDraw05010516492D 21 21 0 0 0 0 0 0 0 0999 V2000 0.7145 -0.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 0.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 0.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 0.0755 0.0000 C 0 ...
CCN(CC)c1cc(N(CC)CC)cc(N(CC)CC)c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][C][Branch1][Branch2][N][Branch1][Ring1][C][C][C][C][=C][Ring1][S]
InChI=1S/C18H33N3/c1-7-19(8-2)16-13-17(20(9-3)10-4)15-18(14-16)21(11-5)12-6/h13-15H,7-12H2,1-6H3
US07314693-20080101-C00046
0008.cdx ChemDraw05010516502D 26 28 0 0 0 0 0 0 0 0999 V2000 -0.5539 0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9664 -0.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5539 -1.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2711 -1.0993 0.0000 C 0 ...
CCN(Cc1ccccc1)c1cccc(N(CC)Cc2ccccc2)c1
[C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][Branch1][#C][N][Branch1][Ring1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][S]
InChI=1S/C24H28N2/c1-3-25(19-21-12-7-5-8-13-21)23-16-11-17-24(18-23)26(4-2)20-22-14-9-6-10-15-22/h5-18H,3-4,19-20H2,1-2H3
US07314693-20080101-C00047
0009.cdx ChemDraw05010516512D 27 31 0 0 0 0 0 0 0 0999 V2000 -2.1883 1.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6008 1.0441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1883 0.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3633 0.3296 0.0000 C 0 ...
CCN(Cc1ccc(C)cc1)c1ccc2ccc3cccc4ccc1c2c34
[C][C][N][Branch1][=N][C][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][C][=C][C][=C][C][=C][C][=C][C][=C][C][=C][C][=C][Ring1][=C][C][Ring1][N][=C][Ring1][#Branch2][Ring1][=Branch1]
InChI=1S/C26H23N/c1-3-27(17-19-9-7-18(2)8-10-19)24-16-14-22-12-11-20-5-4-6-21-13-15-23(24)26(22)25(20)21/h4-16H,3,17H2,1-2H3
US07314693-20080101-C00048
0010.cdx ChemDraw05010516532D 24 26 0 0 0 0 0 0 0 0999 V2000 -1.4916 -0.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6666 -0.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2541 0.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2541 -0.7421 0.0000 C 0 ...
CCN(CC)c1cccc(N(c2ccccc2)c2ccccc2)c1
[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][C][Branch2][Ring1][Ring2][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][Ring1]
InChI=1S/C22H24N2/c1-3-23(4-2)21-16-11-17-22(18-21)24(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-18H,3-4H2,1-2H3
End of preview. Expand in Data Studio

Dataset Card for USPTO OCSR Benchmark

This dataset is a large validation and benchmark set for Optical Chemical Structure Recognition (OCSR), containing 5,719 chemical structure images. The data was sourced from US Patent Office (USPTO) documents and has been curated to provide accurate ground truth MOL files. This Hugging Face version further enriches the dataset by providing pre-computed SMILES, InChI, and SELFIES strings for each molecule.

Dataset Details

Dataset Description

The USPTO OCSR Benchmark was created to serve as a high-quality validation set for OCSR software. It consists of images derived from the US Patent Office Complex Work Units, with each image containing a single chemical structure. The dataset was made possible through a collaboration with Dr. Steve Boyer and Dr. John Kinney and was later updated by Aniko Valko and Keymodule Ltd., who corrected the ground truth MOL files and removed invalid images.

The original distribution included the images, their corresponding MOL files, and a Perl script for benchmarking performance by comparing the standard InChI of predicted structures against the ground truth. This Hugging Face version processes the curated MOL files to generate additional, widely-used chemical representations—canonical SMILES, InChI, and SELFIES—making it immediately useful for training modern deep learning models on image-to-text tasks.

  • Curated by: Original set by Dr. Steve Boyer and Dr. John Kinney. Updated by Aniko Valko and Keymodule Ltd. This Hugging Face version prepared by Hunter Heidenreich.
  • License: Data sourced from the US Patent Office is typically in the public domain. No explicit license was provided with the original dataset.

Dataset Sources

Uses

Direct Use

This dataset is ideal for benchmarking, validating, and training OCSR models, particularly those intended to work with chemical diagrams from patent literature. Common use cases include:

  • Image-to-SMILES translation
  • Evaluating the accuracy of OCSR tools by comparing generated InChIs
  • Fine-tuning vision-language models for the chemistry domain

Out-of-Scope Use

The dataset consists of segmented, single-structure images. It is not suitable for developing or evaluating the document segmentation stage of an OCSR pipeline, which involves finding and isolating chemical diagrams from a full document page. The drawing styles are also specific to patent documents and may not represent the full diversity of diagrams found in textbooks, journals, or handwritten notes.

Dataset Structure

The dataset contains a single split ('train') with 5,719 examples. Each example includes the following fields:

  • id (string): A unique identifier for the example, which is the original filename without the extension.
  • image (image): A PIL-encoded image of the chemical structure.
  • mol (string): The corrected ground truth structure in MOL file format.
  • smiles (string): The canonical SMILES string for the molecule, generated from the mol data using RDKit.
  • selfies (string): The SELFIES (SELF-referencIng Embedded Strings) representation, generated from the smiles string.
  • inchi (string): The standard InChI string for the molecule, generated from the mol data using RDKit.

Dataset Creation

Curation Rationale

The dataset was created to provide a robust and standardized tool for the OCSR community to benchmark and validate their software against a large set of real-world examples from a significant source (US patents).

Source Data

Data Collection and Processing

The source data consists of chemical structure images from US Patent Office Complex Work Units. The initial dataset was later refined by Aniko Valko and Keymodule Ltd. by correcting errors in the ground truth MOL files and removing invalid image-molecule pairs to improve its quality as a benchmark.

For this Hugging Face Hub version, a script was used to process the corrected MOL files. This script utilized the RDKit library to generate canonical SMILES and standard InChI strings, and the selfies library to generate SELFIES representations from the SMILES strings. This pre-processing makes the dataset more accessible for machine learning workflows.

Who are the source data producers?

The underlying chemical structure data originates from documents filed with the US Patent Office. The dataset was curated and released by academic and commercial collaborators.

Bias, Risks, and Limitations

  • Domain Specificity: The data is exclusively from US patents. The conventions, resolution, and styles of chemical drawings may differ from those in patents from other regions or in other types of scientific publications.
  • Pre-processed Images: The images contain only single, segmented structures. This simplifies the recognition task and means models trained on this data will not learn to handle complex pages with multiple diagrams, text, and other figures.
  • Lack of Negative Examples: The dataset contains only valid chemical structure images. It does not include examples of diagrams that are malformed or non-chemical, which could be important for building a truly robust real-world system.

Recommendations

Users should consider this dataset a high-quality validation set for the core task of recognizing segmented chemical structures from patents. For creating a more general-purpose OCSR tool, it is advisable to combine this dataset with others that include different drawing styles (e.g., UOB, CLEF) and more complex, unsegmented document images.

Citation

If you use this dataset, please consider citing the original OSRA paper, as the dataset is a key part of its validation suite. Please also cite this Hugging Face dataset to ensure reproducibility.

BibTeX:

@article{filippov2009optical,
  title={Optical structure recognition software to recover chemical information: OSRA, an open source solution},
  author={Filippov, Igor V and Nicklaus, Marc C},
  journal={Journal of chemical information and modeling},
  volume={49},
  number={3},
  pages={740--743},
  year={2009},
  publisher={ACS Publications}
}

@misc{huggingface_dataset_USPTO,
  author = {Heidenreich, Hunter},
  title = {USPTO OCSR Benchmark},
  year = {2025},
  publisher = {Hugging Face},
  journal = {Hugging Face repository},
  howpublished = {\url{[https://huggingface.co/datasets/hheiden/USPTO_OCSR_benchmark](https://huggingface.co/datasets/hheiden/USPTO_OCSR_benchmark)}}
}
Downloads last month
10

Collection including hheiden/USPTO_OCSR_benchmark